Products 1805457-37-7
CAS 1805457-37-7 appears in our catalog under these names: 2-Chloro-3-fluoro-4-(trifluoromethyl)benzoic acid, 95%, 2-Chloro-3-fluoro-4-(trifluoromethyl)benzoic acid, 2-Chloro-3-fluoro-4-(trifluoromethyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 2,5g, 500mg, 50mg, 100mg.
2-chloro-3-fluoro-4-(trifluoromethyl)benzoic acid (CAS 1805457-37-7) is a chemical compound with the molecular formula C8H3ClF4O2 and a molecular weight of 242.55 g/mol. IUPAC name: 2-chloro-3-fluoro-4-(trifluoromethyl)benzoic acid. InChIKey: YEIOOXKQWUDMRZ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O2 |
|---|---|
| Molecular weight | 242.55 g/mol |
| IUPAC name | 2-chloro-3-fluoro-4-(trifluoromethyl)benzoic acid |
| InChIKey | YEIOOXKQWUDMRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)