Products 130036-17-8
CAS 130036-17-8 is the registry number for 2-Formylcinnamic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
(E)-3-(2-formylphenyl)prop-2-enoic acid (CAS 130036-17-8) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-3-(2-formylphenyl)prop-2-enoic acid. InChIKey: ZIUMNQBNEUJSSL-AATRIKPKSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-3-(2-formylphenyl)prop-2-enoic acid |
| InChIKey | ZIUMNQBNEUJSSL-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)C=O |
Computed by PubChem (NCBI)
Synonyms:
2-Formylcinnamic acid, (E)-3-(2-formylphenyl)prop-2-enoic acid, 3-(2-Formylphenyl)acrylic acid, 2-Propenoic acid, 3-(2-formylphenyl)-, 2-Propenoic acid, 3-(2-formylphenyl)-, (E)- (9CI), (2E)-3-(2-formylphenyl)prop-2-enoic acid, (E)-3-(2-formylphenyl)acrylic acid, 3-(2-Formylphenyl)acrylic Acid; 3-(2-Formylphenyl)-2-propenoic Acid;