CAS 13004-51-8 appears in our catalog under these names: Picosulfate Impurity 8, Bisacodyl Impurity 1, Picosulfate Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(4-hydroxyphenyl)-pyridin-3-ylmethyl]phenol (CAS 13004-51-8) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)-pyridin-3-ylmethyl]phenol. InChIKey: GHMFBXLEROLLRP-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)-pyridin-3-ylmethyl]phenol |
| InChIKey | GHMFBXLEROLLRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)