CAS 1301211-78-8 appears in our catalog under these names: E1R, 99+%, E1R, E1R, 99.83%, E1R, 99.28%. Offered by: AmBeed, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 100mg, 2mg, 25mg, 50mg, 10mg, 1mg, 5mg, 5 mg.
2-[(2S,3R)-2-methyl-5-oxo-3-phenylpyrrolidin-1-yl]acetamide (CAS 1301211-78-8) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: 2-[(2S,3R)-2-methyl-5-oxo-3-phenylpyrrolidin-1-yl]acetamide. InChIKey: ZTGRWYMPQCQTHD-ONGXEEELSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 2-[(2S,3R)-2-methyl-5-oxo-3-phenylpyrrolidin-1-yl]acetamide |
| InChIKey | ZTGRWYMPQCQTHD-ONGXEEELSA-N |
| SMILES | C[C@H]1[C@H](CC(=O)N1CC(=O)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)