Products 1400888-63-2
CAS 1400888-63-2 appears in our catalog under these names: (2R,3R)–E1R, (2R,3R)-E1R, (2R,3R)-E1R, 98.79%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 25 mg, 10 mg, 50 mg.
2-[(2R,3R)-2-methyl-5-oxo-3-phenylpyrrolidin-1-yl]acetamide (CAS 1400888-63-2) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: 2-[(2R,3R)-2-methyl-5-oxo-3-phenylpyrrolidin-1-yl]acetamide. InChIKey: ZTGRWYMPQCQTHD-KOLCDFICSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 2-[(2R,3R)-2-methyl-5-oxo-3-phenylpyrrolidin-1-yl]acetamide |
| InChIKey | ZTGRWYMPQCQTHD-KOLCDFICSA-N |
| SMILES | C[C@@H]1[C@H](CC(=O)N1CC(=O)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)