CAS 70380-49-3 appears in our catalog under these names: (2,3-Dichloro-6-nitrophenyl)methanamine 95%, (2,3-Dichloro-6-nitrophenyl)methanamine, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
(2,3-dichloro-6-nitrophenyl)methanamine (CAS 70380-49-3) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: (2,3-dichloro-6-nitrophenyl)methanamine. InChIKey: NVQPKDBOSKBIEX-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | (2,3-dichloro-6-nitrophenyl)methanamine |
| InChIKey | NVQPKDBOSKBIEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])CN)Cl)Cl |
Computed by PubChem (NCBI)