Products 13036-11-8
CAS 13036-11-8 appears in our catalog under these names: ((2S,4S)-4-Acetoxy-3,4-dihydro-2H-pyran-2-yl)methyl acetate, 95%, 95%, ((2S,4S)-4-Acetoxy-3,4-dihydro-2H-pyran-2-yl)methyl acetate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[(2S,4S)-4-acetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate (CAS 13036-11-8) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: [(2S,4S)-4-acetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate. InChIKey: SMSCPBXUUKNCIG-ZJUUUORDSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | [(2S,4S)-4-acetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| InChIKey | SMSCPBXUUKNCIG-ZJUUUORDSA-N |
| SMILES | CC(=O)OC[C@@H]1C[C@@H](C=CO1)OC(=O)C |
Computed by PubChem (NCBI)