CAS 130373-81-8 is the registry number for 3-(1,3-Dihydro-isoindol-2-yl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(1,3-dihydroisoindol-2-yl)benzoic acid (CAS 130373-81-8) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 3-(1,3-dihydroisoindol-2-yl)benzoic acid. InChIKey: OPNQQNYLEULRRV-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 3-(1,3-dihydroisoindol-2-yl)benzoic acid |
| InChIKey | OPNQQNYLEULRRV-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CN1C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)