CAS 13042-38-1 appears in our catalog under these names: Isosorbide Impurity 3, Isosorbide Acetate, (3R,3aR,6S,6aR)-Hexahydrofuro[3,2-b]furan-3,6-diyl diacetate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
[(3S,3aR,6R,6aR)-6-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate (CAS 13042-38-1) is a chemical compound with the molecular formula C10H14O6 and a molecular weight of 230.21 g/mol. IUPAC name: [(3S,3aR,6R,6aR)-6-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate. InChIKey: NEZQWZBCEHOWJS-UTINFBMNSA-N.
| Molecular formula | C10H14O6 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | [(3S,3aR,6R,6aR)-6-acetyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] acetate |
| InChIKey | NEZQWZBCEHOWJS-UTINFBMNSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)C |
Computed by PubChem (NCBI)