CAS 864531-02-2 is the registry number for tert-Butyl 4-Hydroxy-2,6-dioxotetrahydro-2H-pyran-4-carboxylate. Offered by: TRC. Available pack sizes: 500mg.
Tert-butyl 4-hydroxy-2,6-dioxooxane-4-carboxylate (CAS 864531-02-2) is a chemical compound with the molecular formula C10H14O6 and a molecular weight of 230.21 g/mol. IUPAC name: tert-butyl 4-hydroxy-2,6-dioxooxane-4-carboxylate. InChIKey: ZDILKAFHOPYMAV-UHFFFAOYSA-N.
| Molecular formula | C10H14O6 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-2,6-dioxooxane-4-carboxylate |
| InChIKey | ZDILKAFHOPYMAV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1(CC(=O)OC(=O)C1)O |
Computed by PubChem (NCBI)