Products 74536-45-1

CAS 74536-45-1 is the registry number for Dimethyl 2,3-diacetylsuccinate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dimethyl 2,3-diacetylbutanedioate (CAS 74536-45-1) is a chemical compound with the molecular formula C10H14O6 and a molecular weight of 230.21 g/mol. IUPAC name: dimethyl 2,3-diacetylbutanedioate. InChIKey: MFUZXFWVYOMQBM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O6
Molecular weight230.21 g/mol
IUPAC namedimethyl 2,3-diacetylbutanedioate
InChIKeyMFUZXFWVYOMQBM-UHFFFAOYSA-N
SMILESCC(=O)C(C(C(=O)C)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)