CAS 74536-45-1 is the registry number for Dimethyl 2,3-diacetylsuccinate. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2,3-diacetylbutanedioate (CAS 74536-45-1) is a chemical compound with the molecular formula C10H14O6 and a molecular weight of 230.21 g/mol. IUPAC name: dimethyl 2,3-diacetylbutanedioate. InChIKey: MFUZXFWVYOMQBM-UHFFFAOYSA-N.
| Molecular formula | C10H14O6 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | dimethyl 2,3-diacetylbutanedioate |
| InChIKey | MFUZXFWVYOMQBM-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(C(=O)C)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)