Products 82295-98-5
CAS 82295-98-5 is the registry number for 3,4-Di-o-acetyl-d-glucal, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[(2R,3S,4R)-3-acetyloxy-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-4-yl] acetate (CAS 82295-98-5) is a chemical compound with the molecular formula C10H14O6 and a molecular weight of 230.21 g/mol. IUPAC name: [(2R,3S,4R)-3-acetyloxy-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-4-yl] acetate. InChIKey: LBVCUTFITQDWSU-BBBLOLIVSA-N.
| Molecular formula | C10H14O6 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | [(2R,3S,4R)-3-acetyloxy-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-4-yl] acetate |
| InChIKey | LBVCUTFITQDWSU-BBBLOLIVSA-N |
| SMILES | CC(=O)O[C@@H]1C=CO[C@@H]([C@H]1OC(=O)C)CO |
Computed by PubChem (NCBI)