CAS 32257-17-3 is the registry number for ((3AR,4R,6aR)-2,2-dimethyl-6-oxotetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methyl acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl acetate (CAS 32257-17-3) is a chemical compound with the molecular formula C10H14O6 and a molecular weight of 230.21 g/mol. IUPAC name: [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl acetate. InChIKey: WGDPYNADQWAOTO-BWZBUEFSSA-N.
| Molecular formula | C10H14O6 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl acetate |
| InChIKey | WGDPYNADQWAOTO-BWZBUEFSSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]2[C@H](C(=O)O1)OC(O2)(C)C |
Computed by PubChem (NCBI)