CAS 62054-77-7 appears in our catalog under these names: Methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate, 95%, Methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate (CAS 62054-77-7) is a chemical compound with the molecular formula C10H14O6 and a molecular weight of 230.21 g/mol. IUPAC name: methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate. InChIKey: SUGHRFBQTKIICF-UHFFFAOYSA-N.
| Molecular formula | C10H14O6 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate |
| InChIKey | SUGHRFBQTKIICF-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)CCC(=O)OC)C |
Computed by PubChem (NCBI)