CAS 13051-89-3 appears in our catalog under these names: Dimethyl pyrazine-2,5-dicarboxylate, 97%, Dimethyl Pyrazine-2,5-dicarboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Dimethyl pyrazine-2,5-dicarboxylate (CAS 13051-89-3) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: dimethyl pyrazine-2,5-dicarboxylate. InChIKey: DQGTTXDDKDMEHB-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | dimethyl pyrazine-2,5-dicarboxylate |
| InChIKey | DQGTTXDDKDMEHB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=N1)C(=O)OC |
Computed by PubChem (NCBI)