Products 1305606-71-6

CAS 1305606-71-6 appears in our catalog under these names: 4-Benzamido-2-methylbenzoic acid, 95%, 4-Benzamido-2-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

4-benzamido-2-methylbenzoic acid (CAS 1305606-71-6) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 4-benzamido-2-methylbenzoic acid. InChIKey: NVTQIHPWOLNVOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO3
Molecular weight255.27 g/mol
IUPAC name4-benzamido-2-methylbenzoic acid
InChIKeyNVTQIHPWOLNVOJ-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)NC(=O)C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)