CAS 1305712-42-8 appears in our catalog under these names: 5-Amino-1-ethyl-2,3-dihydro-1H-indol-2-one hydrochloride, 95%, 5-Amino-1-ethyl-2,3-dihydro-1H-indol-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-amino-1-ethyl-3H-indol-2-one;hydrochloride (CAS 1305712-42-8) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 5-amino-1-ethyl-3H-indol-2-one;hydrochloride. InChIKey: YJBUBWXCFOPBOF-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 5-amino-1-ethyl-3H-indol-2-one;hydrochloride |
| InChIKey | YJBUBWXCFOPBOF-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)CC2=C1C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)