Products 1306772-58-6
CAS 1306772-58-6 is the registry number for 4-(4-Bromo-1H-pyrrole-2-carbonyl)morpholine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-bromo-1H-pyrrole-2-carbonyl)morpholine-2-carboxylic acid (CAS 1306772-58-6) is a chemical compound with the molecular formula C10H11BrN2O4 and a molecular weight of 303.11 g/mol. IUPAC name: 4-(4-bromo-1H-pyrrole-2-carbonyl)morpholine-2-carboxylic acid. InChIKey: TTWGMBRESZNVGN-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O4 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | 4-(4-bromo-1H-pyrrole-2-carbonyl)morpholine-2-carboxylic acid |
| InChIKey | TTWGMBRESZNVGN-UHFFFAOYSA-N |
| SMILES | C1COC(CN1C(=O)C2=CC(=CN2)Br)C(=O)O |
Computed by PubChem (NCBI)