Products 1423037-47-1
CAS 1423037-47-1 is the registry number for Ethyl 3-bromo-4-(methylamino)-5-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Ethyl 3-bromo-4-(methylamino)-5-nitrobenzoate (CAS 1423037-47-1) is a chemical compound with the molecular formula C10H11BrN2O4 and a molecular weight of 303.11 g/mol. IUPAC name: ethyl 3-bromo-4-(methylamino)-5-nitrobenzoate. InChIKey: HTPHPPQKSWJOOS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O4 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | ethyl 3-bromo-4-(methylamino)-5-nitrobenzoate |
| InChIKey | HTPHPPQKSWJOOS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Br)NC)[N+](=O)[O-] |
Computed by PubChem (NCBI)