CAS 1486183-97-4 is the registry number for Ethyl (5-bromo-2-nitrophenyl)glycinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 2-(5-bromo-2-nitroanilino)acetate (CAS 1486183-97-4) is a chemical compound with the molecular formula C10H11BrN2O4 and a molecular weight of 303.11 g/mol. IUPAC name: ethyl 2-(5-bromo-2-nitroanilino)acetate. InChIKey: BBPSMJULQULWNW-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O4 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | ethyl 2-(5-bromo-2-nitroanilino)acetate |
| InChIKey | BBPSMJULQULWNW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1=C(C=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)