CAS 2377920-28-8 is the registry number for 2-(2-Bromo-4-nitrophenoxy)-N,N-dimethylacetamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2-bromo-4-nitrophenoxy)-N,N-dimethylacetamide (CAS 2377920-28-8) is a chemical compound with the molecular formula C10H11BrN2O4 and a molecular weight of 303.11 g/mol. IUPAC name: 2-(2-bromo-4-nitrophenoxy)-N,N-dimethylacetamide. InChIKey: CLNURLPGLVJFQN-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O4 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | 2-(2-bromo-4-nitrophenoxy)-N,N-dimethylacetamide |
| InChIKey | CLNURLPGLVJFQN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)