CAS 2094647-74-0 is the registry number for 2-(2-Bromo-4-nitrophenoxy)-N-ethylacetamide, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, 10g, on request.
2-(2-bromo-4-nitrophenoxy)-N-ethylacetamide (CAS 2094647-74-0) is a chemical compound with the molecular formula C10H11BrN2O4 and a molecular weight of 303.11 g/mol. IUPAC name: 2-(2-bromo-4-nitrophenoxy)-N-ethylacetamide. InChIKey: OQFFWJRHUUBNRG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O4 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | 2-(2-bromo-4-nitrophenoxy)-N-ethylacetamide |
| InChIKey | OQFFWJRHUUBNRG-UHFFFAOYSA-N |
| SMILES | CCNC(=O)COC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)