Products 2105337-57-1
CAS 2105337-57-1 is the registry number for 3-Bromo-n-[(2r)-1-hydroxypropan-2-yl]-5-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-N-[(2R)-1-hydroxypropan-2-yl]-5-nitrobenzamide (CAS 2105337-57-1) is a chemical compound with the molecular formula C10H11BrN2O4 and a molecular weight of 303.11 g/mol. IUPAC name: 3-bromo-N-[(2R)-1-hydroxypropan-2-yl]-5-nitrobenzamide. InChIKey: YERMFEKTTPEIDD-ZCFIWIBFSA-N.
| Molecular formula | C10H11BrN2O4 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | 3-bromo-N-[(2R)-1-hydroxypropan-2-yl]-5-nitrobenzamide |
| InChIKey | YERMFEKTTPEIDD-ZCFIWIBFSA-N |
| SMILES | C[C@H](CO)NC(=O)C1=CC(=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)