CAS 1307231-02-2 appears in our catalog under these names: (1R)-4-Bromo-2,3-dihydro-1H-inden-1-amine Hydrochloride, (R)-4-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97%, (R)-4-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 500mg, 250mg, 100mg, 1g.
(1R)-4-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1307231-02-2) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: (1R)-4-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: UDQTVGHTIXPFNZ-SBSPUUFOSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | (1R)-4-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | UDQTVGHTIXPFNZ-SBSPUUFOSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC=C2Br.Cl |
Computed by PubChem (NCBI)