CAS 1307873-37-5 appears in our catalog under these names: (S)-4-Bromo-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (1S)-4-Bromo-2,3-dihydro-1H-inden-1-amine Hydrochloride, (S)–4–Bromo–2,3–dihydro–1H–inden–1–amine hydrochloride, (S)-4-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 95%, (S)-4-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
(1S)-4-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1307873-37-5) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: (1S)-4-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: UDQTVGHTIXPFNZ-FVGYRXGTSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | (1S)-4-bromo-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | UDQTVGHTIXPFNZ-FVGYRXGTSA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC=C2Br.Cl |
Computed by PubChem (NCBI)