Products 1307526-16-4
CAS 1307526-16-4 is the registry number for STING ligand-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-(2-hydroxyethyl)phenyl]-5-nitrofuran-2-carboxamide (CAS 1307526-16-4) is a chemical compound with the molecular formula C13H12N2O5 and a molecular weight of 276.24 g/mol. IUPAC name: N-[4-(2-hydroxyethyl)phenyl]-5-nitrofuran-2-carboxamide. InChIKey: BQYGUFBKMVNUMM-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O5 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | N-[4-(2-hydroxyethyl)phenyl]-5-nitrofuran-2-carboxamide |
| InChIKey | BQYGUFBKMVNUMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCO)NC(=O)C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
STING ligand-2, orb2802288