Products 130826-91-4

CAS 130826-91-4 is the registry number for Metaraminol Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl N-[(1R,2S)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]carbamate (CAS 130826-91-4) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: benzyl N-[(1R,2S)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]carbamate. InChIKey: CRKAMWYOFKCIQK-LRDDRELGSA-N.

Identity
Molecular formulaC17H19NO4
Molecular weight301.34 g/mol
IUPAC namebenzyl N-[(1R,2S)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]carbamate
InChIKeyCRKAMWYOFKCIQK-LRDDRELGSA-N
SMILESC[C@@H]([C@@H](C1=CC(=CC=C1)O)O)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)