CAS 130826-91-4 is the registry number for Metaraminol Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(1R,2S)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]carbamate (CAS 130826-91-4) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: benzyl N-[(1R,2S)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]carbamate. InChIKey: CRKAMWYOFKCIQK-LRDDRELGSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | benzyl N-[(1R,2S)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]carbamate |
| InChIKey | CRKAMWYOFKCIQK-LRDDRELGSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC(=CC=C1)O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)