Products 1951440-05-3

CAS 1951440-05-3 is the registry number for [2-Hydroxy-3-(2-methoxy-phenyl)-propyl]-carbamic acid phenyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Phenyl N-[2-hydroxy-3-(2-methoxyphenyl)propyl]carbamate (CAS 1951440-05-3) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: phenyl N-[2-hydroxy-3-(2-methoxyphenyl)propyl]carbamate. InChIKey: APHQMLBMBPOFNH-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO4
Molecular weight301.34 g/mol
IUPAC namephenyl N-[2-hydroxy-3-(2-methoxyphenyl)propyl]carbamate
InChIKeyAPHQMLBMBPOFNH-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1CC(CNC(=O)OC2=CC=CC=C2)O

Computed by PubChem (NCBI)