CAS 388631-93-4 appears in our catalog under these names: 3-(2-Methoxycarbonyl-vinyl)-indole-1-carboxylic acid tert-butyl ester, 95%, tert-Butyl 3-(3-methoxy-3-oxoprop-1-en-1-yl)-1H-indole-1-carboxylate, 97% mix TBC as stabilizer. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl 3-[(E)-3-methoxy-3-oxoprop-1-enyl]indole-1-carboxylate (CAS 388631-93-4) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: tert-butyl 3-[(E)-3-methoxy-3-oxoprop-1-enyl]indole-1-carboxylate. InChIKey: VSMVLFKTUMKNRW-MDZDMXLPSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | tert-butyl 3-[(E)-3-methoxy-3-oxoprop-1-enyl]indole-1-carboxylate |
| InChIKey | VSMVLFKTUMKNRW-MDZDMXLPSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)/C=C/C(=O)OC |
Computed by PubChem (NCBI)