CAS 913837-62-4 appears in our catalog under these names: 3-[3-Acetyl-5-(4-methoxyphenyl)-2-methyl-1h-pyrrol-1-yl]propanoic acid, 95%, 3-(3-Acetyl-5-(4-methoxyphenyl)-2-methyl-1H-pyrrol-1-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-[3-acetyl-5-(4-methoxyphenyl)-2-methylpyrrol-1-yl]propanoic acid (CAS 913837-62-4) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: 3-[3-acetyl-5-(4-methoxyphenyl)-2-methylpyrrol-1-yl]propanoic acid. InChIKey: VVUMIWJHGFWKAR-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 3-[3-acetyl-5-(4-methoxyphenyl)-2-methylpyrrol-1-yl]propanoic acid |
| InChIKey | VVUMIWJHGFWKAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1CCC(=O)O)C2=CC=C(C=C2)OC)C(=O)C |
Computed by PubChem (NCBI)