Products 7123-76-4
CAS 7123-76-4 appears in our catalog under these names: 3-(4-Nitrophenyl)-1-adamantanecarboxylic acid, 3-(4-Nitrophenyl)adamantane-1-carboxylic acid, 95%, 3-(4-Nitrophenyl)adamantane-1-carboxylic acid, 97%, 3-(4-Nitrophenyl)adamantane-1-carboxylic acid, 97% . Offered by: Biosynth, Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 1g, 2g, 5g, 10g, 25g, 250mg.
3-(4-nitrophenyl)adamantane-1-carboxylic acid (CAS 7123-76-4) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: 3-(4-nitrophenyl)adamantane-1-carboxylic acid. InChIKey: JGYFFTQRRDPOIR-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 3-(4-nitrophenyl)adamantane-1-carboxylic acid |
| InChIKey | JGYFFTQRRDPOIR-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)C(=O)O)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)