CAS 396123-24-3 appears in our catalog under these names: [3-(Ethoxycarbonyl)-2,4-dimethyl-5-phenyl-1h-pyrrol-1-yl]acetic acid, 95%, 2-(3-(Ethoxycarbonyl)-2,4-dimethyl-5-phenyl-1H-pyrrol-1-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3-ethoxycarbonyl-2,4-dimethyl-5-phenylpyrrol-1-yl)acetic acid (CAS 396123-24-3) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: 2-(3-ethoxycarbonyl-2,4-dimethyl-5-phenylpyrrol-1-yl)acetic acid. InChIKey: VUVFGHPEUSMUMX-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 2-(3-ethoxycarbonyl-2,4-dimethyl-5-phenylpyrrol-1-yl)acetic acid |
| InChIKey | VUVFGHPEUSMUMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C1C)C2=CC=CC=C2)CC(=O)O)C |
Computed by PubChem (NCBI)