Products 1308361-72-9

CAS 1308361-72-9 is the registry number for 2-Phenylethyl 2-(methylamino)benzoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-phenylethyl 2-(methylamino)benzoate (CAS 1308361-72-9) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: 2-phenylethyl 2-(methylamino)benzoate. InChIKey: XHLWUBJPVBSWHK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO2
Molecular weight255.31 g/mol
IUPAC name2-phenylethyl 2-(methylamino)benzoate
InChIKeyXHLWUBJPVBSWHK-UHFFFAOYSA-N
SMILESCNC1=CC=CC=C1C(=O)OCCC2=CC=CC=C2

Computed by PubChem (NCBI)