CAS 1309602-47-8 is the registry number for 2-chloro-2,2-difluoro-N-(2-hydroxyphenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-chloro-2,2-difluoro-N-(2-hydroxyphenyl)acetamide (CAS 1309602-47-8) is a chemical compound with the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. IUPAC name: 2-chloro-2,2-difluoro-N-(2-hydroxyphenyl)acetamide. InChIKey: AFUMLAZPVZEOFH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2NO2 |
|---|---|
| Molecular weight | 221.59 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-N-(2-hydroxyphenyl)acetamide |
| InChIKey | AFUMLAZPVZEOFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C(F)(F)Cl)O |
Computed by PubChem (NCBI)