Products 1339551-27-7
CAS 1339551-27-7 appears in our catalog under these names: Methyl 3-amino-2-chloro-4,5-difluorobenzoate, 95%, Methyl 3-amino-2-chloro-4,5-difluorobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 3-amino-2-chloro-4,5-difluorobenzoate (CAS 1339551-27-7) is a chemical compound with the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. IUPAC name: methyl 3-amino-2-chloro-4,5-difluorobenzoate. InChIKey: WWBIAFFDTFFTBB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2NO2 |
|---|---|
| Molecular weight | 221.59 g/mol |
| IUPAC name | methyl 3-amino-2-chloro-4,5-difluorobenzoate |
| InChIKey | WWBIAFFDTFFTBB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1Cl)N)F)F |
Computed by PubChem (NCBI)