Products 2126161-09-7
CAS 2126161-09-7 is the registry number for 2-(6-Chloro-5-methylpyridin-3-yl)-2,2-difluoroacetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(6-chloro-5-methyl-3-pyridinyl)-2,2-difluoroacetic acid (CAS 2126161-09-7) is a chemical compound with the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. IUPAC name: 2-(6-chloro-5-methyl-3-pyridinyl)-2,2-difluoroacetic acid. InChIKey: LWSOOZGWDCVJIU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2NO2 |
|---|---|
| Molecular weight | 221.59 g/mol |
| IUPAC name | 2-(6-chloro-5-methyl-3-pyridinyl)-2,2-difluoroacetic acid |
| InChIKey | LWSOOZGWDCVJIU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)