Products 2734049-56-8

CAS 2734049-56-8 is the registry number for Ethyl 2-chloro-3,5-difluoroisonicotinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-chloro-3,5-difluoropyridine-4-carboxylate (CAS 2734049-56-8) is a chemical compound with the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. IUPAC name: ethyl 2-chloro-3,5-difluoropyridine-4-carboxylate. InChIKey: WTMYBXXOXSPYEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClF2NO2
Molecular weight221.59 g/mol
IUPAC nameethyl 2-chloro-3,5-difluoropyridine-4-carboxylate
InChIKeyWTMYBXXOXSPYEZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=NC=C1F)Cl)F

Computed by PubChem (NCBI)