CAS 2734049-56-8 is the registry number for Ethyl 2-chloro-3,5-difluoroisonicotinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-chloro-3,5-difluoropyridine-4-carboxylate (CAS 2734049-56-8) is a chemical compound with the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. IUPAC name: ethyl 2-chloro-3,5-difluoropyridine-4-carboxylate. InChIKey: WTMYBXXOXSPYEZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2NO2 |
|---|---|
| Molecular weight | 221.59 g/mol |
| IUPAC name | ethyl 2-chloro-3,5-difluoropyridine-4-carboxylate |
| InChIKey | WTMYBXXOXSPYEZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NC=C1F)Cl)F |
Computed by PubChem (NCBI)