Products 2577172-80-4
CAS 2577172-80-4 is the registry number for 2-(5-Chloro-3-methylpyridin-2-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-chloro-3-methyl-2-pyridinyl)-2,2-difluoroacetic acid (CAS 2577172-80-4) is a chemical compound with the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. IUPAC name: 2-(5-chloro-3-methyl-2-pyridinyl)-2,2-difluoroacetic acid. InChIKey: DYGZNZOKQAIAKV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2NO2 |
|---|---|
| Molecular weight | 221.59 g/mol |
| IUPAC name | 2-(5-chloro-3-methyl-2-pyridinyl)-2,2-difluoroacetic acid |
| InChIKey | DYGZNZOKQAIAKV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(C(=O)O)(F)F)Cl |
Computed by PubChem (NCBI)