Products 2649788-89-4

CAS 2649788-89-4 is the registry number for Methyl 4-amino-3-chloro-2,5-difluorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-amino-3-chloro-2,5-difluorobenzoate (CAS 2649788-89-4) is a chemical compound with the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. IUPAC name: methyl 4-amino-3-chloro-2,5-difluorobenzoate. InChIKey: VHHZZNCQANEYOW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClF2NO2
Molecular weight221.59 g/mol
IUPAC namemethyl 4-amino-3-chloro-2,5-difluorobenzoate
InChIKeyVHHZZNCQANEYOW-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C(=C1F)Cl)N)F

Computed by PubChem (NCBI)