CAS 2649788-89-4 is the registry number for Methyl 4-amino-3-chloro-2,5-difluorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-amino-3-chloro-2,5-difluorobenzoate (CAS 2649788-89-4) is a chemical compound with the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. IUPAC name: methyl 4-amino-3-chloro-2,5-difluorobenzoate. InChIKey: VHHZZNCQANEYOW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2NO2 |
|---|---|
| Molecular weight | 221.59 g/mol |
| IUPAC name | methyl 4-amino-3-chloro-2,5-difluorobenzoate |
| InChIKey | VHHZZNCQANEYOW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)Cl)N)F |
Computed by PubChem (NCBI)