CAS 1309647-27-5 is the registry number for 5,8-Dioxo-5,8-dihydronaphthalene-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8-dioxonaphthalene-1-sulfonamide (CAS 1309647-27-5) is a chemical compound with the molecular formula C10H7NO4S and a molecular weight of 237.23 g/mol. IUPAC name: 5,8-dioxonaphthalene-1-sulfonamide. InChIKey: HQXKDLXYRCKYPY-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4S |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 5,8-dioxonaphthalene-1-sulfonamide |
| InChIKey | HQXKDLXYRCKYPY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C=CC2=O)C(=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)