CAS 465514-23-2 appears in our catalog under these names: Methyl 3-(2,5-dioxo-2,5-dihydro-1h-pyrrol-1-yl)thiophene-2-carboxylate, 95%, Methyl 3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)thiophene-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Methyl 3-(2,5-dioxopyrrol-1-yl)thiophene-2-carboxylate (CAS 465514-23-2) is a chemical compound with the molecular formula C10H7NO4S and a molecular weight of 237.23 g/mol. IUPAC name: methyl 3-(2,5-dioxopyrrol-1-yl)thiophene-2-carboxylate. InChIKey: HPNPTFJOBHCYCJ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4S |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | methyl 3-(2,5-dioxopyrrol-1-yl)thiophene-2-carboxylate |
| InChIKey | HPNPTFJOBHCYCJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)