CAS 949984-37-6 is the registry number for 3-Methylthieno(2,3-b)pyridine-2,5-dicarboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-methylthieno[2,3-b]pyridine-2,5-dicarboxylic acid (CAS 949984-37-6) is a chemical compound with the molecular formula C10H7NO4S and a molecular weight of 237.23 g/mol. IUPAC name: 3-methylthieno[2,3-b]pyridine-2,5-dicarboxylic acid. InChIKey: FZWOHGUVKJGXSJ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4S |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 3-methylthieno[2,3-b]pyridine-2,5-dicarboxylic acid |
| InChIKey | FZWOHGUVKJGXSJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=C(C=N2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)