CAS 34084-89-4 appears in our catalog under these names: Methyl 7–nitrobenzo(b)thiophene–2–carboxylate, Methyl 7-nitrobenzo[b]thiophene-2-carboxylate, 95%, 95%, 7-Nitro-benzo[b]thiophene-2-carboxylic acid methyl ester, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
Methyl 7-nitro-1-benzothiophene-2-carboxylate (CAS 34084-89-4) is a chemical compound with the molecular formula C10H7NO4S and a molecular weight of 237.23 g/mol. IUPAC name: methyl 7-nitro-1-benzothiophene-2-carboxylate. InChIKey: RJUVQMBNXODKGH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4S |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | methyl 7-nitro-1-benzothiophene-2-carboxylate |
| InChIKey | RJUVQMBNXODKGH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)