Products 85258-81-7

CAS 85258-81-7 is the registry number for 4-(2,4-Dioxo-1,3-thiazolidin-5-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(2,4-dioxo-1,3-thiazolidin-5-yl)benzoic acid (CAS 85258-81-7) is a chemical compound with the molecular formula C10H7NO4S and a molecular weight of 237.23 g/mol. IUPAC name: 4-(2,4-dioxo-1,3-thiazolidin-5-yl)benzoic acid. InChIKey: XXQLSIIKOZWCLG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7NO4S
Molecular weight237.23 g/mol
IUPAC name4-(2,4-dioxo-1,3-thiazolidin-5-yl)benzoic acid
InChIKeyXXQLSIIKOZWCLG-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2C(=O)NC(=O)S2)C(=O)O

Computed by PubChem (NCBI)