CAS 34084-88-3 is the registry number for 6-Nitro-benzo[b]thiophene-2-carboxylic acid methyl ester, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Methyl 6-nitro-1-benzothiophene-2-carboxylate (CAS 34084-88-3) is a chemical compound with the molecular formula C10H7NO4S and a molecular weight of 237.23 g/mol. IUPAC name: methyl 6-nitro-1-benzothiophene-2-carboxylate. InChIKey: NTWQXMNKLCUVKU-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4S |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | methyl 6-nitro-1-benzothiophene-2-carboxylate |
| InChIKey | NTWQXMNKLCUVKU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)