Products 1309874-26-7
CAS 1309874-26-7 is the registry number for 6-Bromo-4-methyl-2-hydroxy-1,8-naphthyridine. Offered by: TRC. Available pack sizes: 500mg.
6-bromo-4-methyl-1H-1,8-naphthyridin-2-one (CAS 1309874-26-7) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 6-bromo-4-methyl-1H-1,8-naphthyridin-2-one. InChIKey: WVPJOHWTJGPJNS-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 6-bromo-4-methyl-1H-1,8-naphthyridin-2-one |
| InChIKey | WVPJOHWTJGPJNS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C=C(C=N2)Br |
Computed by PubChem (NCBI)