Products 1309935-89-4
CAS 1309935-89-4 appears in our catalog under these names: N-Acetyl Mesalamine-d3, N-Acetyl Mesalazine-d3, >95% (HPLC), N–Acetyl Mesalazine–d3, N-Acetyl mesalazine-d3, N-Acetyl mesalazine-d3-1. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 50mg, 5mg, 25mg, 1 mg, 10 mg.
3-acetamido-2,4,5-trideuterio-6-hydroxybenzoic acid (CAS 1309935-89-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 198.19 g/mol. IUPAC name: 3-acetamido-2,4,5-trideuterio-6-hydroxybenzoic acid. InChIKey: GEFDRROBUCULOD-NRUYWUNFSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | 3-acetamido-2,4,5-trideuterio-6-hydroxybenzoic acid |
| InChIKey | GEFDRROBUCULOD-NRUYWUNFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])C(=O)O)O)[2H] |
Computed by PubChem (NCBI)