CAS 1310095-75-0 appears in our catalog under these names: Methyl 2-(methylamino)-2-(3,4,5-trifluorophenyl)acetate, 95%, Methyl 2-(methylamino)-2-(3,4,5-trifluorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-(methylamino)-2-(3,4,5-trifluorophenyl)acetate (CAS 1310095-75-0) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: methyl 2-(methylamino)-2-(3,4,5-trifluorophenyl)acetate. InChIKey: KEOQOJFJNWHXQN-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | methyl 2-(methylamino)-2-(3,4,5-trifluorophenyl)acetate |
| InChIKey | KEOQOJFJNWHXQN-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC(=C(C(=C1)F)F)F)C(=O)OC |
Computed by PubChem (NCBI)