CAS 131020-57-0 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1h-benzoimidazole-5-carboxylic acid hydrochloride, 95%, 4,5,6,7-Tetrahydro-1h-benzo[d]imidazole-6-carboxylic acid hydrochloride, 95%, Ramosetron Impurity 11 HCl, 4,5,6,7-Tetrahydro-1H-benzo[d]imidazole-5-carboxylic acid hydrochloride 95%, 4,5,6,7-Tetrahydro-1H-benzo[d]imidazole-5-carboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 5g, 100g, 1g, 25g, on request, 250mg, 100mg.
4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid;hydrochloride (CAS 131020-57-0) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid;hydrochloride. InChIKey: HCLOFQMHYZETCL-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | HCLOFQMHYZETCL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)NC=N2.Cl |
Computed by PubChem (NCBI)