CAS 1310404-29-5 is the registry number for tert-Butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (CAS 1310404-29-5) is a chemical compound with the molecular formula C15H23BO4S and a molecular weight of 310.2 g/mol. IUPAC name: tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate. InChIKey: XQVDUVOVGVKJTI-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| InChIKey | XQVDUVOVGVKJTI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)